About 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene
6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene (PubChem CID 134444761) has the molecular formula C13H20S
and a molecular weight of 208.37 g/mol. Its IUPAC name is 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene |
| PubChem CID | 134444761 |
| Molecular Formula | C13H20S |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene |
| SMILES | C=C(C)SC1=CC(C)=CCC1(C)CC |
| InChI | InChI=1S/C13H20S/c1-6-13(5)8-7-11(4)9-12(13)14-10(2)3/h7,9H,2,6,8H2,1,3-5H3 |
| InChIKey | MFDJSFNOQUNBRP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene?
The IUPAC name of 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene (CID 134444761) is 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene.
What is the SMILES notation for 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene?
The canonical SMILES for 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene is C=C(C)SC1=CC(C)=CCC1(C)CC.
What is the InChIKey of 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene?
The InChIKey is MFDJSFNOQUNBRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20S/c1-6-13(5)8-7-11(4)9-12(13)14-10(2)3/h7,9H,2,6,8H2,1,3-5H3.
What are the key properties of 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene?
6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene has a molecular weight of 208.37 g/mol, XLogP of 4.90, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3,6-dimethyl-1-prop-1-en-2-ylsulfanylcyclohexa-1,3-diene is sourced from PubChem (CID 134444761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).