About 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole
4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole (PubChem CID 134444762) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole.
Molecular Properties
| Compound Name | 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
| PubChem CID | 134444762 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
| SMILES | CCc1c2n(c3ccccc13)CCC2 |
| InChI | InChI=1S/C13H15N/c1-2-10-11-6-3-4-7-13(11)14-9-5-8-12(10)14/h3-4,6-7H,2,5,8-9H2,1H3 |
| InChIKey | LZIHIOBIIMOOPL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole?
The IUPAC name of 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole (CID 134444762) is 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole.
What is the SMILES notation for 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole?
The canonical SMILES for 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole is CCc1c2n(c3ccccc13)CCC2.
What is the InChIKey of 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole?
The InChIKey is LZIHIOBIIMOOPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-2-10-11-6-3-4-7-13(11)14-9-5-8-12(10)14/h3-4,6-7H,2,5,8-9H2,1H3.
What are the key properties of 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole?
4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole has a molecular weight of 185.27 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole is sourced from PubChem (CID 134444762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).