C11H13F3N2 — CID 134444981
(E,2E,3Z)-4-ethyl-N-(methylideneamino)-2-(2,2,2-trifluoroethylidene)hexa-3,5-dien-1-imine (PubChem CID 134444981) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is (E,2E,3Z)-4-ethyl-N-(methylideneamino)-2-(2,2,2-trifluoroethylidene)hexa-3,5-dien-1-imine.
| Compound Name | (E,2E,3Z)-4-ethyl-N-(methylideneamino)-2-(2,2,2-trifluoroethylidene)hexa-3,5-dien-1-imine |
|---|---|
| PubChem CID | 134444981 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | (E,2E,3Z)-4-ethyl-N-(methylideneamino)-2-(2,2,2-trifluoroethylidene)hexa-3,5-dien-1-imine |
| SMILES | C=C/C(=C\C(\C=N\N=C)=C/C(F)(F)F)CC |
| InChI | InChI=1S/C11H13F3N2/c1-4-9(5-2)6-10(8-16-15-3)7-11(12,13)14/h4,6-8H,1,3,5H2,2H3/b9-6+,10-7+,16-8+ |
| InChIKey | HBJNPQPOBXLXSB-VYMXUXLESA-N |
| XLogP | 3.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|