C38H24F2N6 — CID 134445321
3,5-bis[3-fluoro-4-(2-pyridin-2-yl-4-pyridinyl)phenyl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 134445321) has the molecular formula C38H24F2N6 and a molecular weight of 602.65 g/mol. Its IUPAC name is 3,5-bis[3-fluoro-4-(2-pyridin-2-yl-4-pyridinyl)phenyl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3,5-bis[3-fluoro-4-(2-pyridin-2-yl-4-pyridinyl)phenyl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 134445321 |
| Molecular Formula | C38H24F2N6 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 3,5-bis[3-fluoro-4-(2-pyridin-2-yl-4-pyridinyl)phenyl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1/C(c2ccc(-c3ccnc(-c4ccccn4)c3)c(F)c2)=CC(c2ccc(-c3ccnc(-c4ccccn4)c3)c(F)c2)=C/C1=N\[H] |
| InChI | InChI=1S/C38H24F2N6/c39-31-18-23(7-9-28(31)25-11-15-45-36(21-25)34-5-1-3-13-43-34)27-17-30(38(42)33(41)20-27)24-8-10-29(32(40)19-24)26-12-16-46-37(22-26)35-6-2-4-14-44-35/h1-22,41-42H/b41-33+,42-38- |
| InChIKey | FXPHGXMBHLQPCT-SSORNERWSA-N |
| XLogP | 8.73 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|