C15H15ClO — CID 134445725
(4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)cyclohepta-2,6-diene-1-carbonyl chloride (PubChem CID 134445725) has the molecular formula C15H15ClO and a molecular weight of 246.74 g/mol. Its IUPAC name is (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)cyclohepta-2,6-diene-1-carbonyl chloride.
| Compound Name | (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)cyclohepta-2,6-diene-1-carbonyl chloride |
|---|---|
| PubChem CID | 134445725 |
| Molecular Formula | C15H15ClO |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)cyclohepta-2,6-diene-1-carbonyl chloride |
| SMILES | C=C/C=C1\C=CC(C)(C(=O)Cl)C=C\C1=C/C=C |
| InChI | InChI=1S/C15H15ClO/c1-4-6-12-8-10-15(3,14(16)17)11-9-13(12)7-5-2/h4-11H,1-2H2,3H3/b12-6+,13-7+ |
| InChIKey | APILUQAAQZZBMP-PWHKKFIBSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|