About 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one
2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one (PubChem CID 134445876) has the molecular formula C19H24ClN3O
and a molecular weight of 345.87 g/mol. Its IUPAC name is 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one.
Molecular Properties
| Compound Name | 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one |
| PubChem CID | 134445876 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one |
| SMILES | C/C=C(\C=C/CC)n1c(CCCCN)nc2cccc(Cl)c2c1=O |
| InChI | InChI=1S/C19H24ClN3O/c1-3-5-9-14(4-2)23-17(12-6-7-13-21)22-16-11-8-10-15(20)18(16)19(23)24/h4-5,8-11H,3,6-7,12-13,21H2,1-2H3/b9-5-,14-4+ |
| InChIKey | XCUCNKOIZGWRGR-BANWFZCWSA-N |
| XLogP | 4.16 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one?
The IUPAC name of 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one (CID 134445876) is 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one.
What is the SMILES notation for 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one?
The canonical SMILES for 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one is C/C=C(\C=C/CC)n1c(CCCCN)nc2cccc(Cl)c2c1=O.
What is the InChIKey of 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one?
The InChIKey is XCUCNKOIZGWRGR-BANWFZCWSA-N. The full InChI is InChI=1S/C19H24ClN3O/c1-3-5-9-14(4-2)23-17(12-6-7-13-21)22-16-11-8-10-15(20)18(16)19(23)24/h4-5,8-11H,3,6-7,12-13,21H2,1-2H3/b9-5-,14-4+.
What are the key properties of 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one?
2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one has a molecular weight of 345.87 g/mol, XLogP of 4.16, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminobutyl)-5-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]quinazolin-4-one is sourced from PubChem (CID 134445876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).