C13H15FN4O — CID 134446366
N-[(3S)-2-(4,5-dihydropyrimidin-4-ylamino)-3-fluorocyclohexa-1,5-dien-1-yl]prop-2-enamide (PubChem CID 134446366) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is N-[(3S)-2-(4,5-dihydropyrimidin-4-ylamino)-3-fluorocyclohexa-1,5-dien-1-yl]prop-2-enamide.
| Compound Name | N-[(3S)-2-(4,5-dihydropyrimidin-4-ylamino)-3-fluorocyclohexa-1,5-dien-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 134446366 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-[(3S)-2-(4,5-dihydropyrimidin-4-ylamino)-3-fluorocyclohexa-1,5-dien-1-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1=C(NC2CC=NC=N2)[C@@H](F)CC=C1 |
| InChI | InChI=1S/C13H15FN4O/c1-2-12(19)17-10-5-3-4-9(14)13(10)18-11-6-7-15-8-16-11/h2-3,5,7-9,11,18H,1,4,6H2,(H,17,19)/t9-,11?/m0/s1 |
| InChIKey | RVPBEFISVUNSEV-FTNKSUMCSA-N |
| XLogP | 1.22 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|