C10H10F6N2O4 — CID 13444668
methyl 1,4-bis(2,2,2-trifluoroacetyl)piperazine-2-carboxylate (PubChem CID 13444668) has the molecular formula C10H10F6N2O4 and a molecular weight of 336.19 g/mol. Its IUPAC name is methyl 1,4-bis(2,2,2-trifluoroacetyl)piperazine-2-carboxylate.
| Compound Name | methyl 1,4-bis(2,2,2-trifluoroacetyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 13444668 |
| Molecular Formula | C10H10F6N2O4 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | methyl 1,4-bis(2,2,2-trifluoroacetyl)piperazine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)C(F)(F)F)CCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F6N2O4/c1-22-6(19)5-4-17(7(20)9(11,12)13)2-3-18(5)8(21)10(14,15)16/h5H,2-4H2,1H3 |
| InChIKey | ZNQPRXPDDWSSNF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |