C18H26O8 — CID 134446865
prop-2-enyl (4R,5S)-5-[(4R,5S)-2,2-dimethyl-5-prop-2-enoxycarbonyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 134446865) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is prop-2-enyl (4R,5S)-5-[(4R,5S)-2,2-dimethyl-5-prop-2-enoxycarbonyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | prop-2-enyl (4R,5S)-5-[(4R,5S)-2,2-dimethyl-5-prop-2-enoxycarbonyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 134446865 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | prop-2-enyl (4R,5S)-5-[(4R,5S)-2,2-dimethyl-5-prop-2-enoxycarbonyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1OC(C)(C)O[C@@H]1[C@@H]1OC(C)(C)O[C@H]1C(=O)OCC=C |
| InChI | InChI=1S/C18H26O8/c1-7-9-21-15(19)13-11(23-17(3,4)25-13)12-14(16(20)22-10-8-2)26-18(5,6)24-12/h7-8,11-14H,1-2,9-10H2,3-6H3/t11-,12+,13+,14- |
| InChIKey | QJBOKTUTMBMVLQ-LVEBTZEWSA-N |
| XLogP | 1.49 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|