C24H31F3N8O2 — CID 134447023
2-[3-[[4-[6-[(E)-6-amino-6-(trifluoromethoxy)hex-3-en-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 134447023) has the molecular formula C24H31F3N8O2 and a molecular weight of 520.56 g/mol. Its IUPAC name is 2-[3-[[4-[6-[(E)-6-amino-6-(trifluoromethoxy)hex-3-en-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[(E)-6-amino-6-(trifluoromethoxy)hex-3-en-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 134447023 |
| Molecular Formula | C24H31F3N8O2 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 2-[3-[[4-[6-[(E)-6-amino-6-(trifluoromethoxy)hex-3-en-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | CC/C(=C\CC(N)OC(F)(F)F)c1cc2cn(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C24H31F3N8O2/c1-2-16(6-9-20(28)37-24(25,26)27)19-12-17-14-35(23(36)34-21(17)33-19)18-7-4-15(5-8-18)13-31-10-3-11-32-22(29)30/h4-8,12,14,20,31H,2-3,9-11,13,28H2,1H3,(H4,29,30,32)(H,33,34,36)/b16-6+ |
| InChIKey | UOEBDSTYZUHCFT-OMCISZLKSA-N |
| XLogP | 2.47 |
| TPSA | 162.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|