C22H33N7O — CID 134447087
2-[3-[[(2E,4E)-5-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-ethenylhexa-2,4-dienyl]amino]propyl]guanidine (PubChem CID 134447087) has the molecular formula C22H33N7O and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[3-[[(2E,4E)-5-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-ethenylhexa-2,4-dienyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(2E,4E)-5-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-ethenylhexa-2,4-dienyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 134447087 |
| Molecular Formula | C22H33N7O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 2-[3-[[(2E,4E)-5-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-ethenylhexa-2,4-dienyl]amino]propyl]guanidine |
| SMILES | C=C/C(=C\C=C(/C)n1cc2cc(C(C)(C)C)[nH]c2nc1=O)CNCCCN=C(N)N |
| InChI | InChI=1S/C22H33N7O/c1-6-16(13-25-10-7-11-26-20(23)24)9-8-15(2)29-14-17-12-18(22(3,4)5)27-19(17)28-21(29)30/h6,8-9,12,14,25H,1,7,10-11,13H2,2-5H3,(H4,23,24,26)(H,27,28,30)/b15-8+,16-9+ |
| InChIKey | IKSNMXSVZHDKPE-BVXMOGEKSA-N |
| XLogP | 2.25 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|