C27H30F3N3O3 — CID 134447251
(E)-3-[4-[6-(3-ethyl-1,2,4-oxadiazol-5-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]prop-2-ene-1,1-diol (PubChem CID 134447251) has the molecular formula C27H30F3N3O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is (E)-3-[4-[6-(3-ethyl-1,2,4-oxadiazol-5-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]prop-2-ene-1,1-diol.
| Compound Name | (E)-3-[4-[6-(3-ethyl-1,2,4-oxadiazol-5-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]prop-2-ene-1,1-diol |
|---|---|
| PubChem CID | 134447251 |
| Molecular Formula | C27H30F3N3O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (E)-3-[4-[6-(3-ethyl-1,2,4-oxadiazol-5-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]prop-2-ene-1,1-diol |
| SMILES | CCc1noc(-c2ccc3c(c2)CC(C)N(CC(C)(C)F)C3c2c(F)cc(/C=C/C(O)O)cc2F)n1 |
| InChI | InChI=1S/C27H30F3N3O3/c1-5-22-31-26(36-32-22)17-7-8-19-18(13-17)10-15(2)33(14-27(3,4)30)25(19)24-20(28)11-16(12-21(24)29)6-9-23(34)35/h6-9,11-13,15,23,25,34-35H,5,10,14H2,1-4H3/b9-6+ |
| InChIKey | BBHNTNTWSBPACO-RMKNXTFCSA-N |
| XLogP | 4.99 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|