C22H35FO — CID 134447490
2-cyclohexyl-5-[(2Z,4Z)-5-ethenyl-4-fluoro-6-methylocta-2,4-dien-3-yl]oxane (PubChem CID 134447490) has the molecular formula C22H35FO and a molecular weight of 334.52 g/mol. Its IUPAC name is 2-cyclohexyl-5-[(2Z,4Z)-5-ethenyl-4-fluoro-6-methylocta-2,4-dien-3-yl]oxane.
| Compound Name | 2-cyclohexyl-5-[(2Z,4Z)-5-ethenyl-4-fluoro-6-methylocta-2,4-dien-3-yl]oxane |
|---|---|
| PubChem CID | 134447490 |
| Molecular Formula | C22H35FO |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 2-cyclohexyl-5-[(2Z,4Z)-5-ethenyl-4-fluoro-6-methylocta-2,4-dien-3-yl]oxane |
| SMILES | C=C/C(=C(F)\C(=C/C)C1CCC(C2CCCCC2)OC1)C(C)CC |
| InChI | InChI=1S/C22H35FO/c1-5-16(4)19(6-2)22(23)20(7-3)18-13-14-21(24-15-18)17-11-9-8-10-12-17/h6-7,16-18,21H,2,5,8-15H2,1,3-4H3/b20-7-,22-19- |
| InChIKey | ZEPTXUHAWJVKPO-LIBKOOGFSA-N |
| XLogP | 6.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|