C15H24F2O2 — CID 134447520
(6Z,8E)-8-ethoxy-6,7-difluoro-4-methyl-5-methylideneundeca-6,8-dien-1-ol (PubChem CID 134447520) has the molecular formula C15H24F2O2 and a molecular weight of 274.35 g/mol. Its IUPAC name is (6Z,8E)-8-ethoxy-6,7-difluoro-4-methyl-5-methylideneundeca-6,8-dien-1-ol.
| Compound Name | (6Z,8E)-8-ethoxy-6,7-difluoro-4-methyl-5-methylideneundeca-6,8-dien-1-ol |
|---|---|
| PubChem CID | 134447520 |
| Molecular Formula | C15H24F2O2 |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (6Z,8E)-8-ethoxy-6,7-difluoro-4-methyl-5-methylideneundeca-6,8-dien-1-ol |
| SMILES | C=C(/C(F)=C(F)\C(=C/CC)OCC)C(C)CCCO |
| InChI | InChI=1S/C15H24F2O2/c1-5-8-13(19-6-2)15(17)14(16)12(4)11(3)9-7-10-18/h8,11,18H,4-7,9-10H2,1-3H3/b13-8+,15-14- |
| InChIKey | CJSDVRQIQWDLIH-VEEDHSDUSA-N |
| XLogP | 4.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|