C17H26F2O — CID 134447531
2-cyclohexyl-5-[(2Z,4Z)-4,5-difluorohexa-2,4-dien-3-yl]oxane (PubChem CID 134447531) has the molecular formula C17H26F2O and a molecular weight of 284.39 g/mol. Its IUPAC name is 2-cyclohexyl-5-[(2Z,4Z)-4,5-difluorohexa-2,4-dien-3-yl]oxane.
| Compound Name | 2-cyclohexyl-5-[(2Z,4Z)-4,5-difluorohexa-2,4-dien-3-yl]oxane |
|---|---|
| PubChem CID | 134447531 |
| Molecular Formula | C17H26F2O |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-cyclohexyl-5-[(2Z,4Z)-4,5-difluorohexa-2,4-dien-3-yl]oxane |
| SMILES | C/C=C(C(\F)=C(/C)F)/C1CCC(C2CCCCC2)OC1 |
| InChI | InChI=1S/C17H26F2O/c1-3-15(17(19)12(2)18)14-9-10-16(20-11-14)13-7-5-4-6-8-13/h3,13-14,16H,4-11H2,1-2H3/b15-3-,17-12- |
| InChIKey | CTDQKVDMAWLYRW-YODNQWBFSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|