About 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene
6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene (PubChem CID 134447724) has the molecular formula C23H36F2O2
and a molecular weight of 382.54 g/mol. Its IUPAC name is 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene |
| PubChem CID | 134447724 |
| Molecular Formula | C23H36F2O2 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene |
| SMILES | CCOC1CC=C(OCC2CCC(C3CCC(CC)CC3)CC2)C(F)=C1F |
| InChI | InChI=1S/C23H36F2O2/c1-3-16-5-9-18(10-6-16)19-11-7-17(8-12-19)15-27-21-14-13-20(26-4-2)22(24)23(21)25/h14,16-20H,3-13,15H2,1-2H3 |
| InChIKey | PBVYVEWCSFRSJQ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene?
The IUPAC name of 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene (CID 134447724) is 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene.
What is the SMILES notation for 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene?
The canonical SMILES for 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene is CCOC1CC=C(OCC2CCC(C3CCC(CC)CC3)CC2)C(F)=C1F.
What is the InChIKey of 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene?
The InChIKey is PBVYVEWCSFRSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36F2O2/c1-3-16-5-9-18(10-6-16)19-11-7-17(8-12-19)15-27-21-14-13-20(26-4-2)22(24)23(21)25/h14,16-20H,3-13,15H2,1-2H3.
What are the key properties of 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene?
6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene has a molecular weight of 382.54 g/mol, XLogP of 6.87, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-3-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-1,2-difluorocyclohexa-1,3-diene is sourced from PubChem (CID 134447724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).