C33H32N2 — CID 134447783
1-N-cyclohepta-1,4,6-trien-1-yl-4-N-(4-cyclohepta-1,4,6-trien-1-ylphenyl)-1-N-phenylcyclohepta-1,3-diene-1,4-diamine (PubChem CID 134447783) has the molecular formula C33H32N2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 1-N-cyclohepta-1,4,6-trien-1-yl-4-N-(4-cyclohepta-1,4,6-trien-1-ylphenyl)-1-N-phenylcyclohepta-1,3-diene-1,4-diamine.
| Compound Name | 1-N-cyclohepta-1,4,6-trien-1-yl-4-N-(4-cyclohepta-1,4,6-trien-1-ylphenyl)-1-N-phenylcyclohepta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134447783 |
| Molecular Formula | C33H32N2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 1-N-cyclohepta-1,4,6-trien-1-yl-4-N-(4-cyclohepta-1,4,6-trien-1-ylphenyl)-1-N-phenylcyclohepta-1,3-diene-1,4-diamine |
| SMILES | C1=CCC=C(c2ccc(NC3=CC=C(N(C4=CCC=CC=C4)c4ccccc4)CCC3)cc2)C=C1 |
| InChI | InChI=1S/C33H32N2/c1-2-7-14-27(13-6-1)28-21-23-30(24-22-28)34-29-15-12-20-33(26-25-29)35(32-18-10-5-11-19-32)31-16-8-3-4-9-17-31/h1-6,8,10-11,13-14,16-19,21-26,34H,7,9,12,15,20H2 |
| InChIKey | XYXRQVBPWDWMLS-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |