About (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine
(2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine (PubChem CID 134448063) has the molecular formula C6H12N2S
and a molecular weight of 144.24 g/mol. Its IUPAC name is (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine.
Analyze (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine?
The IUPAC name of (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine (CID 134448063) is (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine.
What is the SMILES notation for (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine?
The canonical SMILES for (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine is CC1=C(CN)NC(C)S1.
What is the InChIKey of (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine?
The InChIKey is XZVVLRCNQIDQGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S/c1-4-6(3-7)8-5(2)9-4/h5,8H,3,7H2,1-2H3.
What are the key properties of (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine?
(2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine has a molecular weight of 144.24 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine is sourced from PubChem (CID 134448063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).