C18H34F3N3 — CID 134448071
1-N,2-N-dimethyl-2-N-[(3E,5Z)-2-methyl-4-(trifluoromethyl)hepta-3,5-dienyl]-1-N'-pentan-3-ylethane-1,1,2-triamine (PubChem CID 134448071) has the molecular formula C18H34F3N3 and a molecular weight of 349.49 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-2-N-[(3E,5Z)-2-methyl-4-(trifluoromethyl)hepta-3,5-dienyl]-1-N'-pentan-3-ylethane-1,1,2-triamine.
| Compound Name | 1-N,2-N-dimethyl-2-N-[(3E,5Z)-2-methyl-4-(trifluoromethyl)hepta-3,5-dienyl]-1-N'-pentan-3-ylethane-1,1,2-triamine |
|---|---|
| PubChem CID | 134448071 |
| Molecular Formula | C18H34F3N3 |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 1-N,2-N-dimethyl-2-N-[(3E,5Z)-2-methyl-4-(trifluoromethyl)hepta-3,5-dienyl]-1-N'-pentan-3-ylethane-1,1,2-triamine |
| SMILES | C/C=C\C(=C/C(C)CN(C)CC(NC)NC(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C18H34F3N3/c1-7-10-15(18(19,20)21)11-14(4)12-24(6)13-17(22-5)23-16(8-2)9-3/h7,10-11,14,16-17,22-23H,8-9,12-13H2,1-6H3/b10-7-,15-11+ |
| InChIKey | OWDWCGZZOISMOK-UAABIVIQSA-N |
| XLogP | 3.94 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|