C18H21F3N4S — CID 134448076
N-[(3Z)-3-(methylideneamino)-4-propylsulfanylbuta-1,3-dien-2-yl]-1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazol-4-amine (PubChem CID 134448076) has the molecular formula C18H21F3N4S and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[(3Z)-3-(methylideneamino)-4-propylsulfanylbuta-1,3-dien-2-yl]-1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazol-4-amine.
| Compound Name | N-[(3Z)-3-(methylideneamino)-4-propylsulfanylbuta-1,3-dien-2-yl]-1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazol-4-amine |
|---|---|
| PubChem CID | 134448076 |
| Molecular Formula | C18H21F3N4S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-[(3Z)-3-(methylideneamino)-4-propylsulfanylbuta-1,3-dien-2-yl]-1-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazol-4-amine |
| SMILES | C=N/C(=C\SCCC)C(=C)Nc1cn(C2=CCCC(C(F)(F)F)=C2)cn1 |
| InChI | InChI=1S/C18H21F3N4S/c1-4-8-26-11-16(22-3)13(2)24-17-10-25(12-23-17)15-7-5-6-14(9-15)18(19,20)21/h7,9-12,24H,2-6,8H2,1H3/b16-11- |
| InChIKey | NCCZQMIXSFFTDX-WJDWOHSUSA-N |
| XLogP | 5.62 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|