C13H16F3N3 — CID 134448195
1-[(2E,4Z)-2-ethenyl-7,7,7-trifluorohepta-2,4-dienyl]-N-methylimidazol-4-amine (PubChem CID 134448195) has the molecular formula C13H16F3N3 and a molecular weight of 271.29 g/mol. Its IUPAC name is 1-[(2E,4Z)-2-ethenyl-7,7,7-trifluorohepta-2,4-dienyl]-N-methylimidazol-4-amine.
| Compound Name | 1-[(2E,4Z)-2-ethenyl-7,7,7-trifluorohepta-2,4-dienyl]-N-methylimidazol-4-amine |
|---|---|
| PubChem CID | 134448195 |
| Molecular Formula | C13H16F3N3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-[(2E,4Z)-2-ethenyl-7,7,7-trifluorohepta-2,4-dienyl]-N-methylimidazol-4-amine |
| SMILES | C=C/C(=C\C=C/CC(F)(F)F)Cn1cnc(NC)c1 |
| InChI | InChI=1S/C13H16F3N3/c1-3-11(6-4-5-7-13(14,15)16)8-19-9-12(17-2)18-10-19/h3-6,9-10,17H,1,7-8H2,2H3/b5-4-,11-6+ |
| InChIKey | CSFMOBQOCSSLRT-UMEJXRAUSA-N |
| XLogP | 3.55 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|