C10H12F4S — CID 134448224
(3E,5E)-2-ethylsulfanyl-3,7,7,7-tetrafluoro-6-methylhepta-1,3,5-triene (PubChem CID 134448224) has the molecular formula C10H12F4S and a molecular weight of 240.26 g/mol. Its IUPAC name is (3E,5E)-2-ethylsulfanyl-3,7,7,7-tetrafluoro-6-methylhepta-1,3,5-triene.
| Compound Name | (3E,5E)-2-ethylsulfanyl-3,7,7,7-tetrafluoro-6-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 134448224 |
| Molecular Formula | C10H12F4S |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (3E,5E)-2-ethylsulfanyl-3,7,7,7-tetrafluoro-6-methylhepta-1,3,5-triene |
| SMILES | C=C(SCC)/C(F)=C\C=C(/C)C(F)(F)F |
| InChI | InChI=1S/C10H12F4S/c1-4-15-8(3)9(11)6-5-7(2)10(12,13)14/h5-6H,3-4H2,1-2H3/b7-5+,9-6+ |
| InChIKey | YQIFNZASSPTSIH-PDTNFJSOSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|