C66H40N2 — CID 134448228
2-[2-[4-[9-[5-[4-(4-pyridin-2-ylphenyl)phenyl]fluoranthen-3-yl]fluoranthen-2-yl]phenyl]phenyl]pyridine (PubChem CID 134448228) has the molecular formula C66H40N2 and a molecular weight of 861.06 g/mol. Its IUPAC name is 2-[2-[4-[9-[5-[4-(4-pyridin-2-ylphenyl)phenyl]fluoranthen-3-yl]fluoranthen-2-yl]phenyl]phenyl]pyridine.
| Compound Name | 2-[2-[4-[9-[5-[4-(4-pyridin-2-ylphenyl)phenyl]fluoranthen-3-yl]fluoranthen-2-yl]phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 134448228 |
| Molecular Formula | C66H40N2 |
| Molecular Weight | 861.06 g/mol |
| Exact Mass | 860.32 |
| IUPAC Name | 2-[2-[4-[9-[5-[4-(4-pyridin-2-ylphenyl)phenyl]fluoranthen-3-yl]fluoranthen-2-yl]phenyl]phenyl]pyridine |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4cc5c6c(ccc(-c7ccc8c(c7)-c7cc(-c9ccc(-c%10ccccc%10-c%10ccccn%10)cc9)cc9cccc-8c79)c6c4)-c4ccccc4-5)cc3)cc2)nc1 |
| InChI | InChI=1S/C66H40N2/c1-4-14-56(64-17-6-8-35-68-64)51(11-1)45-26-22-43(23-27-45)49-36-48-10-9-15-57-55-31-30-47(37-59(55)62(38-49)65(48)57)52-32-33-58-53-12-2-3-13-54(53)61-40-50(39-60(52)66(58)61)44-20-18-41(19-21-44)42-24-28-46(29-25-42)63-16-5-7-34-67-63/h1-40H |
| InChIKey | JKYBSCGYZDUBMG-UHFFFAOYSA-N |
| XLogP | 17.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.06 |
| LogP ≤ 5 | 17.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |