C20H23F3N2O2 — CID 134448310
3-[2-[3-methoxypropyl(methyl)amino]ethyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 134448310) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 3-[2-[3-methoxypropyl(methyl)amino]ethyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-[2-[3-methoxypropyl(methyl)amino]ethyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 134448310 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-[2-[3-methoxypropyl(methyl)amino]ethyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | COCCCN(C)CCc1cccc(C(=O)Nc2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C20H23F3N2O2/c1-25(8-4-10-27-2)9-7-14-5-3-6-15(11-14)20(26)24-16-12-17(21)19(23)18(22)13-16/h3,5-6,11-13H,4,7-10H2,1-2H3,(H,24,26) |
| InChIKey | PHODUGIQBJRBGP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|