C27H27F2N5O2S — CID 134448564
[5-amino-1-[4-[(2Z,4E)-5,6-difluorohexa-2,4-dienoxy]-2-methylphenyl]pyrazol-4-yl]-[5-methyl-6-(methylsulfanylamino)-1H-indol-2-yl]methanone (PubChem CID 134448564) has the molecular formula C27H27F2N5O2S and a molecular weight of 523.61 g/mol. Its IUPAC name is [5-amino-1-[4-[(2Z,4E)-5,6-difluorohexa-2,4-dienoxy]-2-methylphenyl]pyrazol-4-yl]-[5-methyl-6-(methylsulfanylamino)-1H-indol-2-yl]methanone.
| Compound Name | [5-amino-1-[4-[(2Z,4E)-5,6-difluorohexa-2,4-dienoxy]-2-methylphenyl]pyrazol-4-yl]-[5-methyl-6-(methylsulfanylamino)-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 134448564 |
| Molecular Formula | C27H27F2N5O2S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | [5-amino-1-[4-[(2Z,4E)-5,6-difluorohexa-2,4-dienoxy]-2-methylphenyl]pyrazol-4-yl]-[5-methyl-6-(methylsulfanylamino)-1H-indol-2-yl]methanone |
| SMILES | CSNc1cc2[nH]c(C(=O)c3cnn(-c4ccc(OC/C=C\C=C(\F)CF)cc4C)c3N)cc2cc1C |
| InChI | InChI=1S/C27H27F2N5O2S/c1-16-10-18-12-24(32-23(18)13-22(16)33-37-3)26(35)21-15-31-34(27(21)30)25-8-7-20(11-17(25)2)36-9-5-4-6-19(29)14-28/h4-8,10-13,15,32-33H,9,14,30H2,1-3H3/b5-4-,19-6+ |
| InChIKey | LXZWUQQPMJDERL-KYCOTQASSA-N |
| XLogP | 6.23 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|