C14H21FN2O — CID 134448608
[(2Z,4Z)-2-fluoro-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-4-methylhexa-2,4-dien-3-yl]hydrazine (PubChem CID 134448608) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is [(2Z,4Z)-2-fluoro-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-4-methylhexa-2,4-dien-3-yl]hydrazine.
| Compound Name | [(2Z,4Z)-2-fluoro-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-4-methylhexa-2,4-dien-3-yl]hydrazine |
|---|---|
| PubChem CID | 134448608 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | [(2Z,4Z)-2-fluoro-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-4-methylhexa-2,4-dien-3-yl]hydrazine |
| SMILES | C=C/C(=C\C=C/C)OC/C=C(C)\C(NN)=C(/C)F |
| InChI | InChI=1S/C14H21FN2O/c1-5-7-8-13(6-2)18-10-9-11(3)14(17-16)12(4)15/h5-9,17H,2,10,16H2,1,3-4H3/b7-5-,11-9-,13-8+,14-12- |
| InChIKey | XPDXZINJNKBOJW-ZQSCEQOFSA-N |
| XLogP | 3.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|