C11H22N2 — CID 134448616
(6Z)-8-N,5-dimethylnona-6,8-diene-1,8-diamine (PubChem CID 134448616) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (6Z)-8-N,5-dimethylnona-6,8-diene-1,8-diamine.
| Compound Name | (6Z)-8-N,5-dimethylnona-6,8-diene-1,8-diamine |
|---|---|
| PubChem CID | 134448616 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (6Z)-8-N,5-dimethylnona-6,8-diene-1,8-diamine |
| SMILES | C=C(/C=C\C(C)CCCCN)NC |
| InChI | InChI=1S/C11H22N2/c1-10(6-4-5-9-12)7-8-11(2)13-3/h7-8,10,13H,2,4-6,9,12H2,1,3H3/b8-7- |
| InChIKey | HWWIEUJGWTWHIU-FPLPWBNLSA-N |
| XLogP | 2.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|