C13H18F2O — CID 134448625
(3Z,6E)-4,6-difluoro-3-[(E)-pent-3-en-2-yl]oxyocta-1,3,6-triene (PubChem CID 134448625) has the molecular formula C13H18F2O and a molecular weight of 228.28 g/mol. Its IUPAC name is (3Z,6E)-4,6-difluoro-3-[(E)-pent-3-en-2-yl]oxyocta-1,3,6-triene.
| Compound Name | (3Z,6E)-4,6-difluoro-3-[(E)-pent-3-en-2-yl]oxyocta-1,3,6-triene |
|---|---|
| PubChem CID | 134448625 |
| Molecular Formula | C13H18F2O |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (3Z,6E)-4,6-difluoro-3-[(E)-pent-3-en-2-yl]oxyocta-1,3,6-triene |
| SMILES | C=C/C(OC(C)/C=C/C)=C(/F)C/C(F)=C\C |
| InChI | InChI=1S/C13H18F2O/c1-5-8-10(4)16-13(7-3)12(15)9-11(14)6-2/h5-8,10H,3,9H2,1-2,4H3/b8-5+,11-6+,13-12- |
| InChIKey | ZBGTZLBVONSRSE-PPVUMWMRSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|