C13H14F2N2O — CID 134448633
[(1E,3E,5E)-4-(2,3-difluorophenoxy)hepta-1,3,5-trienyl]hydrazine (PubChem CID 134448633) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is [(1E,3E,5E)-4-(2,3-difluorophenoxy)hepta-1,3,5-trienyl]hydrazine.
| Compound Name | [(1E,3E,5E)-4-(2,3-difluorophenoxy)hepta-1,3,5-trienyl]hydrazine |
|---|---|
| PubChem CID | 134448633 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | [(1E,3E,5E)-4-(2,3-difluorophenoxy)hepta-1,3,5-trienyl]hydrazine |
| SMILES | C/C=C/C(=C\C=C\NN)Oc1cccc(F)c1F |
| InChI | InChI=1S/C13H14F2N2O/c1-2-5-10(6-4-9-17-16)18-12-8-3-7-11(14)13(12)15/h2-9,17H,16H2,1H3/b5-2+,9-4+,10-6+ |
| InChIKey | NMDCTHXFYLSRCL-IESFIAFHSA-N |
| XLogP | 2.78 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|