About [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate
[(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate (PubChem CID 134448724) has the molecular formula C13H18FNO
and a molecular weight of 223.29 g/mol. Its IUPAC name is [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate.
Molecular Properties
| Compound Name | [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate |
| PubChem CID | 134448724 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate |
| SMILES | C=C/N=C(/C=C(C)C)OC/C=C\C=C/CF |
| InChI | InChI=1S/C13H18FNO/c1-4-15-13(11-12(2)3)16-10-8-6-5-7-9-14/h4-8,11H,1,9-10H2,2-3H3/b7-5-,8-6-,15-13- |
| InChIKey | OLRZPNGFKAMYRD-NJSNNQCSSA-N |
| XLogP | 3.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate?
The IUPAC name of [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate (CID 134448724) is [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate.
What is the SMILES notation for [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate?
The canonical SMILES for [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate is C=C/N=C(/C=C(C)C)OC/C=C\C=C/CF.
What is the InChIKey of [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate?
The InChIKey is OLRZPNGFKAMYRD-NJSNNQCSSA-N. The full InChI is InChI=1S/C13H18FNO/c1-4-15-13(11-12(2)3)16-10-8-6-5-7-9-14/h4-8,11H,1,9-10H2,2-3H3/b7-5-,8-6-,15-13-.
What are the key properties of [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate?
[(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate has a molecular weight of 223.29 g/mol, XLogP of 3.59, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z,4Z)-6-fluorohexa-2,4-dienyl] N-ethenyl-3-methylbut-2-enimidate is sourced from PubChem (CID 134448724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).