C16H24FN — CID 134448737
(3Z,5E)-N-[(3Z)-3-fluorohepta-1,3-dien-4-yl]-3,4-dimethylhepta-3,5-dien-2-imine (PubChem CID 134448737) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is (3Z,5E)-N-[(3Z)-3-fluorohepta-1,3-dien-4-yl]-3,4-dimethylhepta-3,5-dien-2-imine.
| Compound Name | (3Z,5E)-N-[(3Z)-3-fluorohepta-1,3-dien-4-yl]-3,4-dimethylhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 134448737 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | (3Z,5E)-N-[(3Z)-3-fluorohepta-1,3-dien-4-yl]-3,4-dimethylhepta-3,5-dien-2-imine |
| SMILES | C=C/C(F)=C(CCC)/N=C(C)/C(C)=C(C)\C=C\C |
| InChI | InChI=1S/C16H24FN/c1-7-10-12(4)13(5)14(6)18-16(11-8-2)15(17)9-3/h7,9-10H,3,8,11H2,1-2,4-6H3/b10-7+,13-12-,16-15-,18-14+ |
| InChIKey | DNNUXGOVBWWZMK-AJXVMQLVSA-N |
| XLogP | 5.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|