C24H33FN4O — CID 134448763
(E)-3-(dimethylamino)-2-[5-fluoro-6-[4-[propan-2-yl(propyl)amino]butan-2-yl]-1H-indole-2-carbonyl]prop-2-enenitrile (PubChem CID 134448763) has the molecular formula C24H33FN4O and a molecular weight of 412.55 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-2-[5-fluoro-6-[4-[propan-2-yl(propyl)amino]butan-2-yl]-1H-indole-2-carbonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(dimethylamino)-2-[5-fluoro-6-[4-[propan-2-yl(propyl)amino]butan-2-yl]-1H-indole-2-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 134448763 |
| Molecular Formula | C24H33FN4O |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (E)-3-(dimethylamino)-2-[5-fluoro-6-[4-[propan-2-yl(propyl)amino]butan-2-yl]-1H-indole-2-carbonyl]prop-2-enenitrile |
| SMILES | CCCN(CCC(C)c1cc2[nH]c(C(=O)/C(C#N)=C/N(C)C)cc2cc1F)C(C)C |
| InChI | InChI=1S/C24H33FN4O/c1-7-9-29(16(2)3)10-8-17(4)20-13-22-18(11-21(20)25)12-23(27-22)24(30)19(14-26)15-28(5)6/h11-13,15-17,27H,7-10H2,1-6H3/b19-15+ |
| InChIKey | HVFDNJAYKCJAGD-XDJHFCHBSA-N |
| XLogP | 5.07 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|