About (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride
(2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride (PubChem CID 134448892) has the molecular formula C7H8ClF3O2S
and a molecular weight of 248.65 g/mol. Its IUPAC name is (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride |
| PubChem CID | 134448892 |
| Molecular Formula | C7H8ClF3O2S |
| Molecular Weight | 248.65 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride |
| SMILES | C/C=C\C(=C/CS(=O)(=O)Cl)C(F)(F)F |
| InChI | InChI=1S/C7H8ClF3O2S/c1-2-3-6(7(9,10)11)4-5-14(8,12)13/h2-4H,5H2,1H3/b3-2-,6-4+ |
| InChIKey | ZXLJGSZXIJVDKI-MGLVMYNNSA-N |
| XLogP | 2.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride?
The IUPAC name of (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride (CID 134448892) is (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride.
What is the SMILES notation for (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride?
The canonical SMILES for (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride is C/C=C\C(=C/CS(=O)(=O)Cl)C(F)(F)F.
What is the InChIKey of (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride?
The InChIKey is ZXLJGSZXIJVDKI-MGLVMYNNSA-N. The full InChI is InChI=1S/C7H8ClF3O2S/c1-2-3-6(7(9,10)11)4-5-14(8,12)13/h2-4H,5H2,1H3/b3-2-,6-4+.
What are the key properties of (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride?
(2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride has a molecular weight of 248.65 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-3-(trifluoromethyl)hexa-2,4-diene-1-sulfonyl chloride is sourced from PubChem (CID 134448892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).