About (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride
(2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride (PubChem CID 134448894) has the molecular formula C8H13ClO3S
and a molecular weight of 224.71 g/mol. Its IUPAC name is (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride |
| PubChem CID | 134448894 |
| Molecular Formula | C8H13ClO3S |
| Molecular Weight | 224.71 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride |
| SMILES | CC/C=C\C(=C/CS(=O)(=O)Cl)OC |
| InChI | InChI=1S/C8H13ClO3S/c1-3-4-5-8(12-2)6-7-13(9,10)11/h4-6H,3,7H2,1-2H3/b5-4-,8-6+ |
| InChIKey | OXGPBPUJZKMUSD-GSGSLZOQSA-N |
| XLogP | 2.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.71 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride?
The IUPAC name of (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride (CID 134448894) is (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride.
What is the SMILES notation for (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride?
The canonical SMILES for (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride is CC/C=C\C(=C/CS(=O)(=O)Cl)OC.
What is the InChIKey of (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride?
The InChIKey is OXGPBPUJZKMUSD-GSGSLZOQSA-N. The full InChI is InChI=1S/C8H13ClO3S/c1-3-4-5-8(12-2)6-7-13(9,10)11/h4-6H,3,7H2,1-2H3/b5-4-,8-6+.
What are the key properties of (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride?
(2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride has a molecular weight of 224.71 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride is sourced from PubChem (CID 134448894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).