(2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride

C8H13ClO3S — CID 134448894

IUPAC(2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride
SMILESCC/C=C\C(=C/CS(=O)(=O)Cl)OC
InChIInChI=1S/C8H13ClO3S/c1-3-4-5-8(12-2)6-7-13(9,10)11/h4-6H,3,7H2,1-2H3/b5-4-,8-6+
InChIKeyOXGPBPUJZKMUSD-GSGSLZOQSA-N
MW224.71 g/mol
LogP2.05
Rot. Bonds5

About (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride

(2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride (PubChem CID 134448894) has the molecular formula C8H13ClO3S and a molecular weight of 224.71 g/mol. Its IUPAC name is (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride.

Molecular Properties

Compound Name(2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride
PubChem CID134448894
Molecular FormulaC8H13ClO3S
Molecular Weight224.71 g/mol
Exact Mass224.03
IUPAC Name(2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride
SMILESCC/C=C\C(=C/CS(=O)(=O)Cl)OC
InChIInChI=1S/C8H13ClO3S/c1-3-4-5-8(12-2)6-7-13(9,10)11/h4-6H,3,7H2,1-2H3/b5-4-,8-6+
InChIKeyOXGPBPUJZKMUSD-GSGSLZOQSA-N
XLogP2.05
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.71
LogP ≤ 52.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride?
The IUPAC name of (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride (CID 134448894) is (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride.
What is the SMILES notation for (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride?
The canonical SMILES for (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride is CC/C=C\C(=C/CS(=O)(=O)Cl)OC.
What is the InChIKey of (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride?
The InChIKey is OXGPBPUJZKMUSD-GSGSLZOQSA-N. The full InChI is InChI=1S/C8H13ClO3S/c1-3-4-5-8(12-2)6-7-13(9,10)11/h4-6H,3,7H2,1-2H3/b5-4-,8-6+.
What are the key properties of (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride?
(2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride has a molecular weight of 224.71 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-3-methoxyhepta-2,4-diene-1-sulfonyl chloride is sourced from PubChem (CID 134448894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).