C10H14F2O2S — CID 134449032
(4E,6E)-2,7-difluoro-5-methylsulfonylnona-1,4,6-triene (PubChem CID 134449032) has the molecular formula C10H14F2O2S and a molecular weight of 236.28 g/mol. Its IUPAC name is (4E,6E)-2,7-difluoro-5-methylsulfonylnona-1,4,6-triene.
| Compound Name | (4E,6E)-2,7-difluoro-5-methylsulfonylnona-1,4,6-triene |
|---|---|
| PubChem CID | 134449032 |
| Molecular Formula | C10H14F2O2S |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (4E,6E)-2,7-difluoro-5-methylsulfonylnona-1,4,6-triene |
| SMILES | C=C(F)C/C=C(\C=C(\F)CC)S(C)(=O)=O |
| InChI | InChI=1S/C10H14F2O2S/c1-4-9(12)7-10(15(3,13)14)6-5-8(2)11/h6-7H,2,4-5H2,1,3H3/b9-7+,10-6+ |
| InChIKey | NSJGUDBGAZGFSN-IDXDHNASSA-N |
| XLogP | 3.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|