C14H23FN2O — CID 134449154
[(2E,4Z)-6-[(2Z,4Z)-6-fluorohepta-2,4-dienoxy]-4-methylhexa-2,4-dien-3-yl]hydrazine (PubChem CID 134449154) has the molecular formula C14H23FN2O and a molecular weight of 254.35 g/mol. Its IUPAC name is [(2E,4Z)-6-[(2Z,4Z)-6-fluorohepta-2,4-dienoxy]-4-methylhexa-2,4-dien-3-yl]hydrazine.
| Compound Name | [(2E,4Z)-6-[(2Z,4Z)-6-fluorohepta-2,4-dienoxy]-4-methylhexa-2,4-dien-3-yl]hydrazine |
|---|---|
| PubChem CID | 134449154 |
| Molecular Formula | C14H23FN2O |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | [(2E,4Z)-6-[(2Z,4Z)-6-fluorohepta-2,4-dienoxy]-4-methylhexa-2,4-dien-3-yl]hydrazine |
| SMILES | C/C=C(NN)\C(C)=C/COC/C=C\C=C/C(C)F |
| InChI | InChI=1S/C14H23FN2O/c1-4-14(17-16)12(2)9-11-18-10-7-5-6-8-13(3)15/h4-9,13,17H,10-11,16H2,1-3H3/b7-5-,8-6-,12-9-,14-4+ |
| InChIKey | PFIHKRUVTNDING-DJFTUPRRSA-N |
| XLogP | 2.79 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|