C15H19FO — CID 134449256
2-fluoro-7-[(2Z,4Z)-2-methylhepta-2,4-dienoxy]cyclohepta-1,3,5-triene (PubChem CID 134449256) has the molecular formula C15H19FO and a molecular weight of 234.31 g/mol. Its IUPAC name is 2-fluoro-7-[(2Z,4Z)-2-methylhepta-2,4-dienoxy]cyclohepta-1,3,5-triene.
| Compound Name | 2-fluoro-7-[(2Z,4Z)-2-methylhepta-2,4-dienoxy]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 134449256 |
| Molecular Formula | C15H19FO |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-fluoro-7-[(2Z,4Z)-2-methylhepta-2,4-dienoxy]cyclohepta-1,3,5-triene |
| SMILES | CC/C=C\C=C(\C)COC1C=CC=CC(F)=C1 |
| InChI | InChI=1S/C15H19FO/c1-3-4-5-8-13(2)12-17-15-10-7-6-9-14(16)11-15/h4-11,15H,3,12H2,1-2H3/b5-4-,13-8- |
| InChIKey | ZJDQADQYZLYINK-NSMXULMMSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|