About (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine
(2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine (PubChem CID 134449399) has the molecular formula C15H28FN
and a molecular weight of 241.39 g/mol. Its IUPAC name is (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine |
| PubChem CID | 134449399 |
| Molecular Formula | C15H28FN |
| Molecular Weight | 241.39 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine |
| SMILES | C/C=C(CC)\C(=C/C)N(C)C(CCC)CCF |
| InChI | InChI=1S/C15H28FN/c1-6-10-14(11-12-16)17(5)15(9-4)13(7-2)8-3/h7,9,14H,6,8,10-12H2,1-5H3/b13-7-,15-9+ |
| InChIKey | QJFYQRQVSCSTQN-MACQCPQCSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine?
The IUPAC name of (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine (CID 134449399) is (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine.
What is the SMILES notation for (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine?
The canonical SMILES for (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine is C/C=C(CC)\C(=C/C)N(C)C(CCC)CCF.
What is the InChIKey of (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine?
The InChIKey is QJFYQRQVSCSTQN-MACQCPQCSA-N. The full InChI is InChI=1S/C15H28FN/c1-6-10-14(11-12-16)17(5)15(9-4)13(7-2)8-3/h7,9,14H,6,8,10-12H2,1-5H3/b13-7-,15-9+.
What are the key properties of (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine?
(2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine has a molecular weight of 241.39 g/mol, XLogP of 4.71, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-4-ethyl-N-(1-fluorohexan-3-yl)-N-methylhexa-2,4-dien-3-amine is sourced from PubChem (CID 134449399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).