C12H22N2O — CID 134449495
[(3E,5Z)-5-methyl-7-prop-2-enoxyocta-3,5-dien-4-yl]hydrazine (PubChem CID 134449495) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is [(3E,5Z)-5-methyl-7-prop-2-enoxyocta-3,5-dien-4-yl]hydrazine.
| Compound Name | [(3E,5Z)-5-methyl-7-prop-2-enoxyocta-3,5-dien-4-yl]hydrazine |
|---|---|
| PubChem CID | 134449495 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | [(3E,5Z)-5-methyl-7-prop-2-enoxyocta-3,5-dien-4-yl]hydrazine |
| SMILES | C=CCOC(C)/C=C(C)\C(=C/CC)NN |
| InChI | InChI=1S/C12H22N2O/c1-5-7-12(14-13)10(3)9-11(4)15-8-6-2/h6-7,9,11,14H,2,5,8,13H2,1,3-4H3/b10-9-,12-7+ |
| InChIKey | BJMLRSZQUVMQRF-ZFNKZLGSSA-N |
| XLogP | 2.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|