About (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine
(2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine (PubChem CID 134449509) has the molecular formula C11H18BrF2NO
and a molecular weight of 298.17 g/mol. Its IUPAC name is (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine |
| PubChem CID | 134449509 |
| Molecular Formula | C11H18BrF2NO |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine |
| SMILES | C=C(OCC(F)CF)/C(Br)=C\CNC(C)C |
| InChI | InChI=1S/C11H18BrF2NO/c1-8(2)15-5-4-11(12)9(3)16-7-10(14)6-13/h4,8,10,15H,3,5-7H2,1-2H3/b11-4+ |
| InChIKey | MGIBTYVRAVVUGX-NYYWCZLTSA-N |
| XLogP | 3.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine?
The IUPAC name of (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine (CID 134449509) is (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine.
What is the SMILES notation for (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine?
The canonical SMILES for (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine is C=C(OCC(F)CF)/C(Br)=C\CNC(C)C.
What is the InChIKey of (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine?
The InChIKey is MGIBTYVRAVVUGX-NYYWCZLTSA-N. The full InChI is InChI=1S/C11H18BrF2NO/c1-8(2)15-5-4-11(12)9(3)16-7-10(14)6-13/h4,8,10,15H,3,5-7H2,1-2H3/b11-4+.
What are the key properties of (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine?
(2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine has a molecular weight of 298.17 g/mol, XLogP of 3.10, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-bromo-4-(2,3-difluoropropoxy)-N-propan-2-ylpenta-2,4-dien-1-amine is sourced from PubChem (CID 134449509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).