About (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine
(3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine (PubChem CID 134449561) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine |
| PubChem CID | 134449561 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine |
| SMILES | C=C(C)/C(=C\CCC)N(C)CCCC |
| InChI | InChI=1S/C13H25N/c1-6-8-10-13(12(3)4)14(5)11-9-7-2/h10H,3,6-9,11H2,1-2,4-5H3/b13-10+ |
| InChIKey | PBTWSNJGRNNOBU-JLHYYAGUSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine?
The IUPAC name of (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine (CID 134449561) is (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine.
What is the SMILES notation for (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine?
The canonical SMILES for (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine is C=C(C)/C(=C\CCC)N(C)CCCC.
What is the InChIKey of (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine?
The InChIKey is PBTWSNJGRNNOBU-JLHYYAGUSA-N. The full InChI is InChI=1S/C13H25N/c1-6-8-10-13(12(3)4)14(5)11-9-7-2/h10H,3,6-9,11H2,1-2,4-5H3/b13-10+.
What are the key properties of (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine?
(3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine has a molecular weight of 195.35 g/mol, XLogP of 3.98, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-butyl-N,2-dimethylhepta-1,3-dien-3-amine is sourced from PubChem (CID 134449561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).