C24H39FN2 — CID 134449612
5-ethyl-8-(2-fluoroethyl)-9-(5-methylidenehept-6-enyl)-2,3,4,5,6,7,7a,8-octahydro-1H-2-benzazonin-10-amine (PubChem CID 134449612) has the molecular formula C24H39FN2 and a molecular weight of 374.59 g/mol. Its IUPAC name is 5-ethyl-8-(2-fluoroethyl)-9-(5-methylidenehept-6-enyl)-2,3,4,5,6,7,7a,8-octahydro-1H-2-benzazonin-10-amine.
| Compound Name | 5-ethyl-8-(2-fluoroethyl)-9-(5-methylidenehept-6-enyl)-2,3,4,5,6,7,7a,8-octahydro-1H-2-benzazonin-10-amine |
|---|---|
| PubChem CID | 134449612 |
| Molecular Formula | C24H39FN2 |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | 5-ethyl-8-(2-fluoroethyl)-9-(5-methylidenehept-6-enyl)-2,3,4,5,6,7,7a,8-octahydro-1H-2-benzazonin-10-amine |
| SMILES | C=CC(=C)CCCCC1=C(N)C=C2CNCCC(CC)CCC2C1CCF |
| InChI | InChI=1S/C24H39FN2/c1-4-18(3)8-6-7-9-23-22(12-14-25)21-11-10-19(5-2)13-15-27-17-20(21)16-24(23)26/h4,16,19,21-22,27H,1,3,5-15,17,26H2,2H3 |
| InChIKey | KEMWTMWMQJSQNH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|