C25H46N2O — CID 134449694
(5E,7Z)-3-(1-aminoethyl)-9,11-dimethyl-7-(methylaminomethyl)-12-propylhexadeca-1,5,7-trien-4-one (PubChem CID 134449694) has the molecular formula C25H46N2O and a molecular weight of 390.66 g/mol. Its IUPAC name is (5E,7Z)-3-(1-aminoethyl)-9,11-dimethyl-7-(methylaminomethyl)-12-propylhexadeca-1,5,7-trien-4-one.
| Compound Name | (5E,7Z)-3-(1-aminoethyl)-9,11-dimethyl-7-(methylaminomethyl)-12-propylhexadeca-1,5,7-trien-4-one |
|---|---|
| PubChem CID | 134449694 |
| Molecular Formula | C25H46N2O |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.36 |
| IUPAC Name | (5E,7Z)-3-(1-aminoethyl)-9,11-dimethyl-7-(methylaminomethyl)-12-propylhexadeca-1,5,7-trien-4-one |
| SMILES | C=CC(C(=O)/C=C/C(=C/C(C)CC(C)C(CCC)CCCC)CNC)C(C)N |
| InChI | InChI=1S/C25H46N2O/c1-8-11-13-23(12-9-2)20(5)16-19(4)17-22(18-27-7)14-15-25(28)24(10-3)21(6)26/h10,14-15,17,19-21,23-24,27H,3,8-9,11-13,16,18,26H2,1-2,4-7H3/b15-14+,22-17- |
| InChIKey | VERXPAHZLHLUFP-ACBMTUMASA-N |
| XLogP | 5.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|