C18H28BrNO — CID 134449707
4-[(2E,4E,7E)-3-bromodeca-2,4,7-trien-4-yl]oxy-1-cyclopropylpiperidine (PubChem CID 134449707) has the molecular formula C18H28BrNO and a molecular weight of 354.33 g/mol. Its IUPAC name is 4-[(2E,4E,7E)-3-bromodeca-2,4,7-trien-4-yl]oxy-1-cyclopropylpiperidine.
| Compound Name | 4-[(2E,4E,7E)-3-bromodeca-2,4,7-trien-4-yl]oxy-1-cyclopropylpiperidine |
|---|---|
| PubChem CID | 134449707 |
| Molecular Formula | C18H28BrNO |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[(2E,4E,7E)-3-bromodeca-2,4,7-trien-4-yl]oxy-1-cyclopropylpiperidine |
| SMILES | C/C=C(Br)\C(=C/C/C=C/CC)OC1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C18H28BrNO/c1-3-5-6-7-8-18(17(19)4-2)21-16-11-13-20(14-12-16)15-9-10-15/h4-6,8,15-16H,3,7,9-14H2,1-2H3/b6-5+,17-4+,18-8+ |
| InChIKey | ACUSQAFUHVXMRD-HAQQXUQTSA-N |
| XLogP | 5.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|