About N-methylfluoren-9-imine
N-methylfluoren-9-imine (PubChem CID 13445002) has the molecular formula C14H11N
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-methylfluoren-9-imine.
Molecular Properties
| Compound Name | N-methylfluoren-9-imine |
| PubChem CID | 13445002 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-methylfluoren-9-imine |
| SMILES | CN=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H11N/c1-15-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2-9H,1H3 |
| InChIKey | MLCILXJJBNJFNC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylfluoren-9-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylfluoren-9-imine?
The IUPAC name of N-methylfluoren-9-imine (CID 13445002) is N-methylfluoren-9-imine.
What is the SMILES notation for N-methylfluoren-9-imine?
The canonical SMILES for N-methylfluoren-9-imine is CN=C1c2ccccc2-c2ccccc21.
What is the InChIKey of N-methylfluoren-9-imine?
The InChIKey is MLCILXJJBNJFNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N/c1-15-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2-9H,1H3.
What are the key properties of N-methylfluoren-9-imine?
N-methylfluoren-9-imine has a molecular weight of 193.25 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylfluoren-9-imine is sourced from PubChem (CID 13445002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).