C30H48O5 — CID 134450531
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoate (PubChem CID 134450531) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoate |
|---|---|
| PubChem CID | 134450531 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)C(=O)OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C30H48O5/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-32-28(6-2)29(31)33-25-27-26-34-30(3,4)35-27/h7-8,10-11,13-14,16-17,19-20,27-28H,5-6,9,12,15,18,21-26H2,1-4H3/b8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | BMPPQUPZDGJUIC-NEUKSRIFSA-N |
| XLogP | 7.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|