C16H22N2 — CID 134450662
(2E,4Z)-N,N',2-tris(ethenyl)-5-propan-2-ylhepta-2,4,6-trienimidamide (PubChem CID 134450662) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (2E,4Z)-N,N',2-tris(ethenyl)-5-propan-2-ylhepta-2,4,6-trienimidamide.
| Compound Name | (2E,4Z)-N,N',2-tris(ethenyl)-5-propan-2-ylhepta-2,4,6-trienimidamide |
|---|---|
| PubChem CID | 134450662 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (2E,4Z)-N,N',2-tris(ethenyl)-5-propan-2-ylhepta-2,4,6-trienimidamide |
| SMILES | C=C/N=C(NC=C)/C(C=C)=C/C=C(\C=C)C(C)C |
| InChI | InChI=1S/C16H22N2/c1-7-14(13(5)6)11-12-15(8-2)16(17-9-3)18-10-4/h7-13H,1-4H2,5-6H3,(H,17,18)/b14-11+,15-12+ |
| InChIKey | UXBMUIWMXPFDSP-LCPPQYOVSA-N |
| XLogP | 4.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|