About 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole
4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole (PubChem CID 134451233) has the molecular formula C15H20F2N2
and a molecular weight of 266.33 g/mol. Its IUPAC name is 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole.
Molecular Properties
| Compound Name | 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole |
| PubChem CID | 134451233 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole |
| SMILES | CC(C)(C)c1c(F)c(F)c(C(C)(C)C)c2c1=NCN=2 |
| InChI | InChI=1S/C15H20F2N2/c1-14(2,3)8-10(16)11(17)9(15(4,5)6)13-12(8)18-7-19-13/h7H2,1-6H3 |
| InChIKey | BGCJHXHGIPJZGY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole?
The IUPAC name of 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole (CID 134451233) is 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole.
What is the SMILES notation for 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole?
The canonical SMILES for 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole is CC(C)(C)c1c(F)c(F)c(C(C)(C)C)c2c1=NCN=2.
What is the InChIKey of 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole?
The InChIKey is BGCJHXHGIPJZGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N2/c1-14(2,3)8-10(16)11(17)9(15(4,5)6)13-12(8)18-7-19-13/h7H2,1-6H3.
What are the key properties of 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole?
4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole has a molecular weight of 266.33 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-ditert-butyl-5,6-difluoro-2H-benzimidazole is sourced from PubChem (CID 134451233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).