C14H22N2 — CID 134451247
2,5-ditert-butyl-3,6-dihydropyrrolo[3,2-b]pyrrole (PubChem CID 134451247) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,5-ditert-butyl-3,6-dihydropyrrolo[3,2-b]pyrrole.
| Compound Name | 2,5-ditert-butyl-3,6-dihydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 134451247 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2,5-ditert-butyl-3,6-dihydropyrrolo[3,2-b]pyrrole |
| SMILES | CC(C)(C)C1=NC2=C(C1)N=C(C(C)(C)C)C2 |
| InChI | InChI=1S/C14H22N2/c1-13(2,3)11-7-9-10(15-11)8-12(16-9)14(4,5)6/h7-8H2,1-6H3 |
| InChIKey | LPWXXKSLYMRAFY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |