About 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole
4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole (PubChem CID 134451261) has the molecular formula C16H20N4
and a molecular weight of 268.36 g/mol. Its IUPAC name is 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole.
Molecular Properties
| Compound Name | 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole |
| PubChem CID | 134451261 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole |
| SMILES | CC(C)(C)c1c2c(c(C(C)(C)C)c3c1=NCN=3)N=C=N2 |
| InChI | InChI=1S/C16H20N4/c1-15(2,3)9-11-13(19-7-17-11)10(16(4,5)6)14-12(9)18-8-20-14/h7H2,1-6H3 |
| InChIKey | PLPBWUISGAKJIC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole?
The IUPAC name of 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole (CID 134451261) is 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole.
What is the SMILES notation for 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole?
The canonical SMILES for 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole is CC(C)(C)c1c2c(c(C(C)(C)C)c3c1=NCN=3)N=C=N2.
What is the InChIKey of 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole?
The InChIKey is PLPBWUISGAKJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4/c1-15(2,3)9-11-13(19-7-17-11)10(16(4,5)6)14-12(9)18-8-20-14/h7H2,1-6H3.
What are the key properties of 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole?
4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole has a molecular weight of 268.36 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-ditert-butyl-6H-imidazo[4,5-f]benzimidazole is sourced from PubChem (CID 134451261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).